C19H42O2Si2 — CID 102075587
tert-butyl-dimethyl-[(2R,4R)-4-triethylsilyloxyhept-6-en-2-yl]oxysilane (PubChem CID 102075587) has the molecular formula C19H42O2Si2 and a molecular weight of 358.72 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,4R)-4-triethylsilyloxyhept-6-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,4R)-4-triethylsilyloxyhept-6-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 102075587 |
| Molecular Formula | C19H42O2Si2 |
| Molecular Weight | 358.72 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,4R)-4-triethylsilyloxyhept-6-en-2-yl]oxysilane |
| SMILES | C=CC[C@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H42O2Si2/c1-11-15-18(21-23(12-2,13-3)14-4)16-17(5)20-22(9,10)19(6,7)8/h11,17-18H,1,12-16H2,2-10H3/t17-,18-/m1/s1 |
| InChIKey | MAAWBKZSEFDHAO-QZTJIDSGSA-N |
| XLogP | 6.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.72 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|