C8H8Br2O — CID 117104086
1-(2,6-dibromophenyl)ethanol (PubChem CID 117104086) has the molecular formula C8H8Br2O and a molecular weight of 279.96 g/mol. Its IUPAC name is 1-(2,6-dibromophenyl)ethanol.
| Compound Name | 1-(2,6-dibromophenyl)ethanol |
|---|---|
| PubChem CID | 117104086 |
| Molecular Formula | C8H8Br2O |
| Molecular Weight | 279.96 g/mol |
| Exact Mass | 277.89 |
| IUPAC Name | 1-(2,6-dibromophenyl)ethanol |
| SMILES | CC(O)c1c(Br)cccc1Br |
| InChI | InChI=1S/C8H8Br2O/c1-5(11)8-6(9)3-2-4-7(8)10/h2-5,11H,1H3 |
| InChIKey | KHWCJWKVYJCFKR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.96 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |