C11H17N3OS — CID 117106344
3-methoxy-6-(thian-3-ylmethyl)pyridazin-4-amine (PubChem CID 117106344) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-methoxy-6-(thian-3-ylmethyl)pyridazin-4-amine.
| Compound Name | 3-methoxy-6-(thian-3-ylmethyl)pyridazin-4-amine |
|---|---|
| PubChem CID | 117106344 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-methoxy-6-(thian-3-ylmethyl)pyridazin-4-amine |
| SMILES | COc1nnc(CC2CCCSC2)cc1N |
| InChI | InChI=1S/C11H17N3OS/c1-15-11-10(12)6-9(13-14-11)5-8-3-2-4-16-7-8/h6,8H,2-5,7H2,1H3,(H2,12,13) |
| InChIKey | LLSDQRZZSGWWCW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |