C12H8BrF3N2O — CID 117106762
5-bromo-3-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyridazin-6-one (PubChem CID 117106762) has the molecular formula C12H8BrF3N2O and a molecular weight of 333.11 g/mol. Its IUPAC name is 5-bromo-3-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyridazin-6-one.
| Compound Name | 5-bromo-3-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 117106762 |
| Molecular Formula | C12H8BrF3N2O |
| Molecular Weight | 333.11 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 5-bromo-3-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]nc(Cc2ccc(C(F)(F)F)cc2)cc1Br |
| InChI | InChI=1S/C12H8BrF3N2O/c13-10-6-9(17-18-11(10)19)5-7-1-3-8(4-2-7)12(14,15)16/h1-4,6H,5H2,(H,18,19) |
| InChIKey | AQZQLPRQAAOHHZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.11 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |