C14H8F6N2O3 — CID 86646547
2-fluoro-5-[[6-oxo-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-3-yl]methyl]benzoic acid (PubChem CID 86646547) has the molecular formula C14H8F6N2O3 and a molecular weight of 366.22 g/mol. Its IUPAC name is 2-fluoro-5-[[6-oxo-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-3-yl]methyl]benzoic acid.
| Compound Name | 2-fluoro-5-[[6-oxo-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 86646547 |
| Molecular Formula | C14H8F6N2O3 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-fluoro-5-[[6-oxo-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cc(Cc2cc(C(F)(F)C(F)(F)F)c(=O)[nH]n2)ccc1F |
| InChI | InChI=1S/C14H8F6N2O3/c15-10-2-1-6(4-8(10)12(24)25)3-7-5-9(11(23)22-21-7)13(16,17)14(18,19)20/h1-2,4-5H,3H2,(H,22,23)(H,24,25) |
| InChIKey | XZCCPIXMEGCNPI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|