C29H27F4N5O4 — CID 68864935
3-[[3-(3-benzyl-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)-4-fluorophenyl]methyl]-5-ethyl-1H-pyridazin-6-one;2,2,2-trifluoroacetate (PubChem CID 68864935) has the molecular formula C29H27F4N5O4 and a molecular weight of 585.56 g/mol. Its IUPAC name is 3-[[3-(3-benzyl-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)-4-fluorophenyl]methyl]-5-ethyl-1H-pyridazin-6-one;2,2,2-trifluoroacetate.
| Compound Name | 3-[[3-(3-benzyl-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)-4-fluorophenyl]methyl]-5-ethyl-1H-pyridazin-6-one;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68864935 |
| Molecular Formula | C29H27F4N5O4 |
| Molecular Weight | 585.56 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 3-[[3-(3-benzyl-1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)-4-fluorophenyl]methyl]-5-ethyl-1H-pyridazin-6-one;2,2,2-trifluoroacetate |
| SMILES | CCc1cc(Cc2ccc(F)c(C(=O)N3CC[n+]4c(Cc5ccccc5)c[nH]c4C3)c2)n[nH]c1=O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H26FN5O2.C2HF3O2/c1-2-20-15-21(30-31-26(20)34)12-19-8-9-24(28)23(14-19)27(35)32-10-11-33-22(16-29-25(33)17-32)13-18-6-4-3-5-7-18;3-2(4,5)1(6)7/h3-9,14-16H,2,10-13,17H2,1H3,(H,31,34);(H,6,7) |
| InChIKey | ZLNWTTPOMXYXLS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 125.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|