C26H24F4N7O2+ — CID 87605061
3-[[4-fluoro-3-[3-[4-(trifluoromethyl)anilino]-1,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-7-carbonyl]phenyl]methyl]-4,5-dimethyl-1H-pyridazin-6-one (PubChem CID 87605061) has the molecular formula C26H24F4N7O2+ and a molecular weight of 542.52 g/mol. Its IUPAC name is 3-[[4-fluoro-3-[3-[4-(trifluoromethyl)anilino]-1,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-7-carbonyl]phenyl]methyl]-4,5-dimethyl-1H-pyridazin-6-one.
| Compound Name | 3-[[4-fluoro-3-[3-[4-(trifluoromethyl)anilino]-1,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-7-carbonyl]phenyl]methyl]-4,5-dimethyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 87605061 |
| Molecular Formula | C26H24F4N7O2+ |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 3-[[4-fluoro-3-[3-[4-(trifluoromethyl)anilino]-1,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-7-carbonyl]phenyl]methyl]-4,5-dimethyl-1H-pyridazin-6-one |
| SMILES | Cc1c(Cc2ccc(F)c(C(=O)N3CC[n+]4c(Nc5ccc(C(F)(F)F)cc5)n[nH]c4C3)c2)n[nH]c(=O)c1C |
| InChI | InChI=1S/C26H23F4N7O2/c1-14-15(2)23(38)34-32-21(14)12-16-3-8-20(27)19(11-16)24(39)36-9-10-37-22(13-36)33-35-25(37)31-18-6-4-17(5-7-18)26(28,29)30/h3-8,11H,9-10,12-13H2,1-2H3,(H2,31,34,35,38)/p+1 |
| InChIKey | GXAAVXDOYPNWLO-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|