C25H21F4N6O4S+ — CID 68974884
[7-[5-[(4,5-dimethyl-6-oxo-1H-pyridazin-3-yl)methyl]-2-fluorobenzoyl]-3-thiophen-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 68974884) has the molecular formula C25H21F4N6O4S+ and a molecular weight of 577.54 g/mol. Its IUPAC name is [7-[5-[(4,5-dimethyl-6-oxo-1H-pyridazin-3-yl)methyl]-2-fluorobenzoyl]-3-thiophen-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [7-[5-[(4,5-dimethyl-6-oxo-1H-pyridazin-3-yl)methyl]-2-fluorobenzoyl]-3-thiophen-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68974884 |
| Molecular Formula | C25H21F4N6O4S+ |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | [7-[5-[(4,5-dimethyl-6-oxo-1H-pyridazin-3-yl)methyl]-2-fluorobenzoyl]-3-thiophen-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1c(Cc2ccc(F)c(C(=O)N3CC[n+]4c(-c5cccs5)nn(OC(=O)C(F)(F)F)c4C3)c2)n[nH]c(=O)c1C |
| InChI | InChI=1S/C25H20F4N6O4S/c1-13-14(2)22(36)31-30-18(13)11-15-5-6-17(26)16(10-15)23(37)33-7-8-34-20(12-33)35(39-24(38)25(27,28)29)32-21(34)19-4-3-9-40-19/h3-6,9-10H,7-8,11-12H2,1-2H3/p+1 |
| InChIKey | MZHXJWBWXXLEDN-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|