C19H13Cl2F4N8O2+ — CID 87461643
2,3-dichloro-8-[[4-fluoro-3-[3-(trifluoromethyl)-1,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-7-carbonyl]phenyl]methyl]-6H-imidazo[1,2-d][1,2,4]triazin-5-one (PubChem CID 87461643) has the molecular formula C19H13Cl2F4N8O2+ and a molecular weight of 532.27 g/mol. Its IUPAC name is 2,3-dichloro-8-[[4-fluoro-3-[3-(trifluoromethyl)-1,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-7-carbonyl]phenyl]methyl]-6H-imidazo[1,2-d][1,2,4]triazin-5-one.
| Compound Name | 2,3-dichloro-8-[[4-fluoro-3-[3-(trifluoromethyl)-1,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-7-carbonyl]phenyl]methyl]-6H-imidazo[1,2-d][1,2,4]triazin-5-one |
|---|---|
| PubChem CID | 87461643 |
| Molecular Formula | C19H13Cl2F4N8O2+ |
| Molecular Weight | 532.27 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | 2,3-dichloro-8-[[4-fluoro-3-[3-(trifluoromethyl)-1,5,6,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-4-ium-7-carbonyl]phenyl]methyl]-6H-imidazo[1,2-d][1,2,4]triazin-5-one |
| SMILES | O=C(c1cc(Cc2n[nH]c(=O)n3c(Cl)c(Cl)nc23)ccc1F)N1CC[n+]2c(C(F)(F)F)n[nH]c2C1 |
| InChI | InChI=1S/C19H12Cl2F4N8O2/c20-13-14(21)33-15(26-13)11(27-30-18(33)35)6-8-1-2-10(22)9(5-8)16(34)31-3-4-32-12(7-31)28-29-17(32)19(23,24)25/h1-2,5H,3-4,6-7H2,(H,26,30,35)/p+1 |
| InChIKey | CGEJBAMODZXCCT-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|