C19H17Cl2FN6O2 — CID 24985399
8-[[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-4-fluorophenyl]methyl]-2,3-dichloro-6H-imidazo[1,2-d][1,2,4]triazin-5-one (PubChem CID 24985399) has the molecular formula C19H17Cl2FN6O2 and a molecular weight of 451.29 g/mol. Its IUPAC name is 8-[[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-4-fluorophenyl]methyl]-2,3-dichloro-6H-imidazo[1,2-d][1,2,4]triazin-5-one.
| Compound Name | 8-[[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-4-fluorophenyl]methyl]-2,3-dichloro-6H-imidazo[1,2-d][1,2,4]triazin-5-one |
|---|---|
| PubChem CID | 24985399 |
| Molecular Formula | C19H17Cl2FN6O2 |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 8-[[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-4-fluorophenyl]methyl]-2,3-dichloro-6H-imidazo[1,2-d][1,2,4]triazin-5-one |
| SMILES | O=C(c1cc(Cc2n[nH]c(=O)n3c(Cl)c(Cl)nc23)ccc1F)N1CC2CNCC2C1 |
| InChI | InChI=1S/C19H17Cl2FN6O2/c20-15-16(21)28-17(24-15)14(25-26-19(28)30)4-9-1-2-13(22)12(3-9)18(29)27-7-10-5-23-6-11(10)8-27/h1-3,10-11,23H,4-8H2,(H,26,30) |
| InChIKey | QXMAHJDTQITGNB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |