C29H28FN5O2 — CID 126699570
4-[[4-fluoro-3-[2-[(6-methyl-2-pyridinyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 126699570) has the molecular formula C29H28FN5O2 and a molecular weight of 497.57 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[2-[(6-methyl-2-pyridinyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[2-[(6-methyl-2-pyridinyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 126699570 |
| Molecular Formula | C29H28FN5O2 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 4-[[4-fluoro-3-[2-[(6-methyl-2-pyridinyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | Cc1cccc(CN2CC3CN(C(=O)c4cc(Cc5n[nH]c(=O)c6ccccc56)ccc4F)CC3C2)n1 |
| InChI | InChI=1S/C29H28FN5O2/c1-18-5-4-6-22(31-18)17-34-13-20-15-35(16-21(20)14-34)29(37)25-11-19(9-10-26(25)30)12-27-23-7-2-3-8-24(23)28(36)33-32-27/h2-11,20-21H,12-17H2,1H3,(H,33,36) |
| InChIKey | VBMZVZWJLDLTQF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |