C25H28FN5O2 — CID 56833021
4-[[3-[2-(2-aminoethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one (PubChem CID 56833021) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-[[3-[2-(2-aminoethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-[2-(2-aminoethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 56833021 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-[[3-[2-(2-aminoethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| SMILES | NCCN1CC2CCN(C(=O)c3cc(Cc4n[nH]c(=O)c5ccccc45)ccc3F)CC2C1 |
| InChI | InChI=1S/C25H28FN5O2/c26-22-6-5-16(12-23-19-3-1-2-4-20(19)24(32)29-28-23)11-21(22)25(33)31-9-7-17-13-30(10-8-27)14-18(17)15-31/h1-6,11,17-18H,7-10,12-15,27H2,(H,29,32) |
| InChIKey | WWADMPKJXAYEGY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |