C25H25FN6O2 — CID 129261855
4-[[3-[(4aR,8aS)-2-imino-1-methanimidoyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one (PubChem CID 129261855) has the molecular formula C25H25FN6O2 and a molecular weight of 460.51 g/mol. Its IUPAC name is 4-[[3-[(4aR,8aS)-2-imino-1-methanimidoyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-[(4aR,8aS)-2-imino-1-methanimidoyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 129261855 |
| Molecular Formula | C25H25FN6O2 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 4-[[3-[(4aR,8aS)-2-imino-1-methanimidoyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridine-6-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| SMILES | [H]/N=C/N1/C(=N/[H])CC[C@@H]2CN(C(=O)c3cc(Cc4n[nH]c(=O)c5ccccc45)ccc3F)CC[C@@H]21 |
| InChI | InChI=1S/C25H25FN6O2/c26-20-7-5-15(12-21-17-3-1-2-4-18(17)24(33)30-29-21)11-19(20)25(34)31-10-9-22-16(13-31)6-8-23(28)32(22)14-27/h1-5,7,11,14,16,22,27-28H,6,8-10,12-13H2,(H,30,33)/b27-14+,28-23+/t16-,22+/m1/s1 |
| InChIKey | NXQRYAFCSATXPX-RKFAKETLSA-N |
| XLogP | 3.16 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|