C15H12F4N2O3 — CID 68504288
5-[[5-ethyl-6-oxo-4-(trifluoromethyl)-1H-pyridazin-3-yl]methyl]-2-fluorobenzoic acid (PubChem CID 68504288) has the molecular formula C15H12F4N2O3 and a molecular weight of 344.26 g/mol. Its IUPAC name is 5-[[5-ethyl-6-oxo-4-(trifluoromethyl)-1H-pyridazin-3-yl]methyl]-2-fluorobenzoic acid.
| Compound Name | 5-[[5-ethyl-6-oxo-4-(trifluoromethyl)-1H-pyridazin-3-yl]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 68504288 |
| Molecular Formula | C15H12F4N2O3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 5-[[5-ethyl-6-oxo-4-(trifluoromethyl)-1H-pyridazin-3-yl]methyl]-2-fluorobenzoic acid |
| SMILES | CCc1c(C(F)(F)F)c(Cc2ccc(F)c(C(=O)O)c2)n[nH]c1=O |
| InChI | InChI=1S/C15H12F4N2O3/c1-2-8-12(15(17,18)19)11(20-21-13(8)22)6-7-3-4-10(16)9(5-7)14(23)24/h3-5H,2,6H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | GRJVEIQYZSSOSL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |