C13H16O4 — CID 117108638
methyl 2-hydroxy-2-[4-[(1-hydroxycyclopropyl)methyl]phenyl]acetate (PubChem CID 117108638) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[4-[(1-hydroxycyclopropyl)methyl]phenyl]acetate.
| Compound Name | methyl 2-hydroxy-2-[4-[(1-hydroxycyclopropyl)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 117108638 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | methyl 2-hydroxy-2-[4-[(1-hydroxycyclopropyl)methyl]phenyl]acetate |
| SMILES | COC(=O)C(O)c1ccc(CC2(O)CC2)cc1 |
| InChI | InChI=1S/C13H16O4/c1-17-12(15)11(14)10-4-2-9(3-5-10)8-13(16)6-7-13/h2-5,11,14,16H,6-8H2,1H3 |
| InChIKey | UEWFBTVDOFILIQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |