C11H15N3O — CID 117109848
(7-methoxy-1,3-dimethylindazol-5-yl)methanamine (PubChem CID 117109848) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is (7-methoxy-1,3-dimethylindazol-5-yl)methanamine.
| Compound Name | (7-methoxy-1,3-dimethylindazol-5-yl)methanamine |
|---|---|
| PubChem CID | 117109848 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | (7-methoxy-1,3-dimethylindazol-5-yl)methanamine |
| SMILES | COc1cc(CN)cc2c(C)nn(C)c12 |
| InChI | InChI=1S/C11H15N3O/c1-7-9-4-8(6-12)5-10(15-3)11(9)14(2)13-7/h4-5H,6,12H2,1-3H3 |
| InChIKey | ATBTUMFSXVVMPV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |