C13H18F2N2 — CID 117112812
5-(1-aminocyclopentyl)-2,3-difluoro-N,N-dimethylaniline (PubChem CID 117112812) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 5-(1-aminocyclopentyl)-2,3-difluoro-N,N-dimethylaniline.
| Compound Name | 5-(1-aminocyclopentyl)-2,3-difluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 117112812 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-(1-aminocyclopentyl)-2,3-difluoro-N,N-dimethylaniline |
| SMILES | CN(C)c1cc(C2(N)CCCC2)cc(F)c1F |
| InChI | InChI=1S/C13H18F2N2/c1-17(2)11-8-9(7-10(14)12(11)15)13(16)5-3-4-6-13/h7-8H,3-6,16H2,1-2H3 |
| InChIKey | DCKCHNXGUMQYRQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |