C11H14FNO2 — CID 117301230
5-(1-aminocyclopentyl)-3-fluorobenzene-1,2-diol (PubChem CID 117301230) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 5-(1-aminocyclopentyl)-3-fluorobenzene-1,2-diol.
| Compound Name | 5-(1-aminocyclopentyl)-3-fluorobenzene-1,2-diol |
|---|---|
| PubChem CID | 117301230 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-(1-aminocyclopentyl)-3-fluorobenzene-1,2-diol |
| SMILES | NC1(c2cc(O)c(O)c(F)c2)CCCC1 |
| InChI | InChI=1S/C11H14FNO2/c12-8-5-7(6-9(14)10(8)15)11(13)3-1-2-4-11/h5-6,14-15H,1-4,13H2 |
| InChIKey | PFMFMZYOQYBVFW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|