C22H21F2N3O3 — CID 11711315
methyl 2-fluoro-6-[3-fluoro-4-[(4-imidazol-1-ylbutanoylamino)methyl]phenyl]benzoate (PubChem CID 11711315) has the molecular formula C22H21F2N3O3 and a molecular weight of 413.42 g/mol. Its IUPAC name is methyl 2-fluoro-6-[3-fluoro-4-[(4-imidazol-1-ylbutanoylamino)methyl]phenyl]benzoate.
| Compound Name | methyl 2-fluoro-6-[3-fluoro-4-[(4-imidazol-1-ylbutanoylamino)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 11711315 |
| Molecular Formula | C22H21F2N3O3 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | methyl 2-fluoro-6-[3-fluoro-4-[(4-imidazol-1-ylbutanoylamino)methyl]phenyl]benzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1ccc(CNC(=O)CCCn2ccnc2)c(F)c1 |
| InChI | InChI=1S/C22H21F2N3O3/c1-30-22(29)21-17(4-2-5-18(21)23)15-7-8-16(19(24)12-15)13-26-20(28)6-3-10-27-11-9-25-14-27/h2,4-5,7-9,11-12,14H,3,6,10,13H2,1H3,(H,26,28) |
| InChIKey | YDGMBVYDKXJUHB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |