C12H12BrClF3N — CID 117114683
1-(2-bromo-4-chloro-3,5,6-trifluorophenyl)cyclohexan-1-amine (PubChem CID 117114683) has the molecular formula C12H12BrClF3N and a molecular weight of 342.59 g/mol. Its IUPAC name is 1-(2-bromo-4-chloro-3,5,6-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | 1-(2-bromo-4-chloro-3,5,6-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 117114683 |
| Molecular Formula | C12H12BrClF3N |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 1-(2-bromo-4-chloro-3,5,6-trifluorophenyl)cyclohexan-1-amine |
| SMILES | NC1(c2c(F)c(F)c(Cl)c(F)c2Br)CCCCC1 |
| InChI | InChI=1S/C12H12BrClF3N/c13-7-6(12(18)4-2-1-3-5-12)9(15)11(17)8(14)10(7)16/h1-5,18H2 |
| InChIKey | NBBKDEJMDKIYGZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|