C18H21F2N7O3 — CID 11711474
N-[[3-[3-fluoro-4-[4-fluoro-4-(tetrazol-1-yl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 11711474) has the molecular formula C18H21F2N7O3 and a molecular weight of 421.41 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-fluoro-4-(tetrazol-1-yl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-fluoro-4-(tetrazol-1-yl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 11711474 |
| Molecular Formula | C18H21F2N7O3 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-fluoro-4-(tetrazol-1-yl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCC(F)(n4cnnn4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H21F2N7O3/c1-12(28)21-9-14-10-26(17(29)30-14)13-2-3-16(15(19)8-13)25-6-4-18(20,5-7-25)27-11-22-23-24-27/h2-3,8,11,14H,4-7,9-10H2,1H3,(H,21,28) |
| InChIKey | DHKLUUKIGKJKTJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|