C12H19NO3S — CID 117115430
2-amino-2-[4-(2-methylsulfonylpropan-2-yl)phenyl]ethanol (PubChem CID 117115430) has the molecular formula C12H19NO3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-amino-2-[4-(2-methylsulfonylpropan-2-yl)phenyl]ethanol.
| Compound Name | 2-amino-2-[4-(2-methylsulfonylpropan-2-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 117115430 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-amino-2-[4-(2-methylsulfonylpropan-2-yl)phenyl]ethanol |
| SMILES | CC(C)(c1ccc(C(N)CO)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C12H19NO3S/c1-12(2,17(3,15)16)10-6-4-9(5-7-10)11(13)8-14/h4-7,11,14H,8,13H2,1-3H3 |
| InChIKey | QJCMLKYXRQTEQG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |