C13H20N2 — CID 117116788
N,N,2-trimethyl-5-pyrrolidin-2-ylaniline (PubChem CID 117116788) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N,N,2-trimethyl-5-pyrrolidin-2-ylaniline.
| Compound Name | N,N,2-trimethyl-5-pyrrolidin-2-ylaniline |
|---|---|
| PubChem CID | 117116788 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N,N,2-trimethyl-5-pyrrolidin-2-ylaniline |
| SMILES | Cc1ccc(C2CCCN2)cc1N(C)C |
| InChI | InChI=1S/C13H20N2/c1-10-6-7-11(9-13(10)15(2)3)12-5-4-8-14-12/h6-7,9,12,14H,4-5,8H2,1-3H3 |
| InChIKey | HRUZJXKVLIFCIR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |