C13H21Cl3N2 — CID 155976846
2-chloro-N,N-dimethyl-5-piperidin-2-ylaniline;dihydrochloride (PubChem CID 155976846) has the molecular formula C13H21Cl3N2 and a molecular weight of 311.68 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-5-piperidin-2-ylaniline;dihydrochloride.
| Compound Name | 2-chloro-N,N-dimethyl-5-piperidin-2-ylaniline;dihydrochloride |
|---|---|
| PubChem CID | 155976846 |
| Molecular Formula | C13H21Cl3N2 |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-chloro-N,N-dimethyl-5-piperidin-2-ylaniline;dihydrochloride |
| SMILES | CN(C)c1cc(C2CCCCN2)ccc1Cl.Cl.Cl |
| InChI | InChI=1S/C13H19ClN2.2ClH/c1-16(2)13-9-10(6-7-11(13)14)12-5-3-4-8-15-12;;/h6-7,9,12,15H,3-5,8H2,1-2H3;2*1H |
| InChIKey | JWZLVDCNEXNSMW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |