C12H13ClF3N — CID 171195520
(2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]piperidine (PubChem CID 171195520) has the molecular formula C12H13ClF3N and a molecular weight of 263.69 g/mol. Its IUPAC name is (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]piperidine.
| Compound Name | (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 171195520 |
| Molecular Formula | C12H13ClF3N |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | (2R)-2-[4-chloro-3-(trifluoromethyl)phenyl]piperidine |
| SMILES | FC(F)(F)c1cc([C@H]2CCCCN2)ccc1Cl |
| InChI | InChI=1S/C12H13ClF3N/c13-10-5-4-8(7-9(10)12(14,15)16)11-3-1-2-6-17-11/h4-5,7,11,17H,1-3,6H2/t11-/m1/s1 |
| InChIKey | FVYRVICBPLTSTG-LLVKDONJSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |