C12H14Cl2F3NO — CID 171195028
(2S)-2-[3-chloro-4-(trifluoromethoxy)phenyl]piperidine;hydrochloride (PubChem CID 171195028) has the molecular formula C12H14Cl2F3NO and a molecular weight of 316.15 g/mol. Its IUPAC name is (2S)-2-[3-chloro-4-(trifluoromethoxy)phenyl]piperidine;hydrochloride.
| Compound Name | (2S)-2-[3-chloro-4-(trifluoromethoxy)phenyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 171195028 |
| Molecular Formula | C12H14Cl2F3NO |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (2S)-2-[3-chloro-4-(trifluoromethoxy)phenyl]piperidine;hydrochloride |
| SMILES | Cl.FC(F)(F)Oc1ccc([C@@H]2CCCCN2)cc1Cl |
| InChI | InChI=1S/C12H13ClF3NO.ClH/c13-9-7-8(10-3-1-2-6-17-10)4-5-11(9)18-12(14,15)16;/h4-5,7,10,17H,1-3,6H2;1H/t10-;/m0./s1 |
| InChIKey | UCNDVGBDGXGRQA-PPHPATTJSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |