C10H10Cl2F3NO — CID 171197328
(2R)-2-[3-chloro-4-(trifluoromethoxy)phenyl]azetidine;hydrochloride (PubChem CID 171197328) has the molecular formula C10H10Cl2F3NO and a molecular weight of 288.10 g/mol. Its IUPAC name is (2R)-2-[3-chloro-4-(trifluoromethoxy)phenyl]azetidine;hydrochloride.
| Compound Name | (2R)-2-[3-chloro-4-(trifluoromethoxy)phenyl]azetidine;hydrochloride |
|---|---|
| PubChem CID | 171197328 |
| Molecular Formula | C10H10Cl2F3NO |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | (2R)-2-[3-chloro-4-(trifluoromethoxy)phenyl]azetidine;hydrochloride |
| SMILES | Cl.FC(F)(F)Oc1ccc([C@H]2CCN2)cc1Cl |
| InChI | InChI=1S/C10H9ClF3NO.ClH/c11-7-5-6(8-3-4-15-8)1-2-9(7)16-10(12,13)14;/h1-2,5,8,15H,3-4H2;1H/t8-;/m1./s1 |
| InChIKey | STJCQDVTZZBNRG-DDWIOCJRSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |