C13H16ClF3N2 — CID 117117199
[5-[3-chloro-5-(trifluoromethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine (PubChem CID 117117199) has the molecular formula C13H16ClF3N2 and a molecular weight of 292.73 g/mol. Its IUPAC name is [5-[3-chloro-5-(trifluoromethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [5-[3-chloro-5-(trifluoromethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117117199 |
| Molecular Formula | C13H16ClF3N2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [5-[3-chloro-5-(trifluoromethyl)phenyl]-1-methylpyrrolidin-3-yl]methanamine |
| SMILES | CN1CC(CN)CC1c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16ClF3N2/c1-19-7-8(6-18)2-12(19)9-3-10(13(15,16)17)5-11(14)4-9/h3-5,8,12H,2,6-7,18H2,1H3 |
| InChIKey | MNIQVPRDGDUGSU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |