C15H16F3NO2 — CID 117119580
3-[1-ethyl-4-(trifluoromethyl)indol-3-yl]-2-methylpropanoic acid (PubChem CID 117119580) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 3-[1-ethyl-4-(trifluoromethyl)indol-3-yl]-2-methylpropanoic acid.
| Compound Name | 3-[1-ethyl-4-(trifluoromethyl)indol-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117119580 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-[1-ethyl-4-(trifluoromethyl)indol-3-yl]-2-methylpropanoic acid |
| SMILES | CCn1cc(CC(C)C(=O)O)c2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C15H16F3NO2/c1-3-19-8-10(7-9(2)14(20)21)13-11(15(16,17)18)5-4-6-12(13)19/h4-6,8-9H,3,7H2,1-2H3,(H,20,21) |
| InChIKey | CBDDCUPFNWYDHE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |