C15H19NO4S — CID 117172113
1-ethyl-3-(propan-2-ylsulfonylmethyl)indole-4-carboxylic acid (PubChem CID 117172113) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-ethyl-3-(propan-2-ylsulfonylmethyl)indole-4-carboxylic acid.
| Compound Name | 1-ethyl-3-(propan-2-ylsulfonylmethyl)indole-4-carboxylic acid |
|---|---|
| PubChem CID | 117172113 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-ethyl-3-(propan-2-ylsulfonylmethyl)indole-4-carboxylic acid |
| SMILES | CCn1cc(CS(=O)(=O)C(C)C)c2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C15H19NO4S/c1-4-16-8-11(9-21(19,20)10(2)3)14-12(15(17)18)6-5-7-13(14)16/h5-8,10H,4,9H2,1-3H3,(H,17,18) |
| InChIKey | XUMGVQGZRWKLSM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |