C21H22F3NO2 — CID 155739241
ethane;1-ethyl-4-[[4-(trifluoromethyl)phenyl]methyl]indole-3-carboxylic acid (PubChem CID 155739241) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is ethane;1-ethyl-4-[[4-(trifluoromethyl)phenyl]methyl]indole-3-carboxylic acid.
| Compound Name | ethane;1-ethyl-4-[[4-(trifluoromethyl)phenyl]methyl]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 155739241 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | ethane;1-ethyl-4-[[4-(trifluoromethyl)phenyl]methyl]indole-3-carboxylic acid |
| SMILES | CC.CCn1cc(C(=O)O)c2c(Cc3ccc(C(F)(F)F)cc3)cccc21 |
| InChI | InChI=1S/C19H16F3NO2.C2H6/c1-2-23-11-15(18(24)25)17-13(4-3-5-16(17)23)10-12-6-8-14(9-7-12)19(20,21)22;1-2/h3-9,11H,2,10H2,1H3,(H,24,25);1-2H3 |
| InChIKey | GUYMLXRPPJJFRC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |