C12H15NO2S — CID 117120144
1-(4-methyl-1,1-dioxo-1-benzothiophen-2-yl)propan-2-amine (PubChem CID 117120144) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 1-(4-methyl-1,1-dioxo-1-benzothiophen-2-yl)propan-2-amine.
| Compound Name | 1-(4-methyl-1,1-dioxo-1-benzothiophen-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 117120144 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-(4-methyl-1,1-dioxo-1-benzothiophen-2-yl)propan-2-amine |
| SMILES | Cc1cccc2c1C=C(CC(C)N)S2(=O)=O |
| InChI | InChI=1S/C12H15NO2S/c1-8-4-3-5-12-11(8)7-10(6-9(2)13)16(12,14)15/h3-5,7,9H,6,13H2,1-2H3 |
| InChIKey | RCXRJKITMXUVRS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |