About 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol
2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol (PubChem CID 117121394) has the molecular formula C10H11NO3S
and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol |
| PubChem CID | 117121394 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol |
| SMILES | NCCC1=Cc2cc(O)ccc2S1(=O)=O |
| InChI | InChI=1S/C10H11NO3S/c11-4-3-9-6-7-5-8(12)1-2-10(7)15(9,13)14/h1-2,5-6,12H,3-4,11H2 |
| InChIKey | CAUDVACCQLFXSM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol?
The IUPAC name of 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol (CID 117121394) is 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol.
What is the SMILES notation for 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol?
The canonical SMILES for 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol is NCCC1=Cc2cc(O)ccc2S1(=O)=O.
What is the InChIKey of 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol?
The InChIKey is CAUDVACCQLFXSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3S/c11-4-3-9-6-7-5-8(12)1-2-10(7)15(9,13)14/h1-2,5-6,12H,3-4,11H2.
What are the key properties of 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol?
2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol has a molecular weight of 225.27 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-1,1-dioxo-1-benzothiophen-5-ol is sourced from PubChem (CID 117121394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).