C12H15NO3S — CID 117121401
3-(5-methoxy-1,1-dioxo-1-benzothiophen-2-yl)propan-1-amine (PubChem CID 117121401) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 3-(5-methoxy-1,1-dioxo-1-benzothiophen-2-yl)propan-1-amine.
| Compound Name | 3-(5-methoxy-1,1-dioxo-1-benzothiophen-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 117121401 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 3-(5-methoxy-1,1-dioxo-1-benzothiophen-2-yl)propan-1-amine |
| SMILES | COc1ccc2c(c1)C=C(CCCN)S2(=O)=O |
| InChI | InChI=1S/C12H15NO3S/c1-16-10-4-5-12-9(7-10)8-11(3-2-6-13)17(12,14)15/h4-5,7-8H,2-3,6,13H2,1H3 |
| InChIKey | FTZRGJUDBHPKLG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |