C9H7ClO3S — CID 117121311
(5-chloro-1,1-dioxo-1-benzothiophen-2-yl)methanol (PubChem CID 117121311) has the molecular formula C9H7ClO3S and a molecular weight of 230.67 g/mol. Its IUPAC name is (5-chloro-1,1-dioxo-1-benzothiophen-2-yl)methanol.
| Compound Name | (5-chloro-1,1-dioxo-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 117121311 |
| Molecular Formula | C9H7ClO3S |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | (5-chloro-1,1-dioxo-1-benzothiophen-2-yl)methanol |
| SMILES | O=S1(=O)C(CO)=Cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H7ClO3S/c10-7-1-2-9-6(3-7)4-8(5-11)14(9,12)13/h1-4,11H,5H2 |
| InChIKey | VQARJLFLTPSNLC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |