C12H14ClNO2S — CID 117195887
3-(6-chloro-1,1-dioxo-1-benzothiophen-2-yl)-N-methylpropan-1-amine (PubChem CID 117195887) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is 3-(6-chloro-1,1-dioxo-1-benzothiophen-2-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(6-chloro-1,1-dioxo-1-benzothiophen-2-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 117195887 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3-(6-chloro-1,1-dioxo-1-benzothiophen-2-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1=Cc2ccc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C12H14ClNO2S/c1-14-6-2-3-11-7-9-4-5-10(13)8-12(9)17(11,15)16/h4-5,7-8,14H,2-3,6H2,1H3 |
| InChIKey | RCAYQEXGBKYUTI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|