C13H16ClNO2S — CID 19429650
N-[(6-chloro-1,1-dioxo-1-benzothiophen-2-yl)methyl]butan-1-amine (PubChem CID 19429650) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is N-[(6-chloro-1,1-dioxo-1-benzothiophen-2-yl)methyl]butan-1-amine.
| Compound Name | N-[(6-chloro-1,1-dioxo-1-benzothiophen-2-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 19429650 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-[(6-chloro-1,1-dioxo-1-benzothiophen-2-yl)methyl]butan-1-amine |
| SMILES | CCCCNCC1=Cc2ccc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C13H16ClNO2S/c1-2-3-6-15-9-12-7-10-4-5-11(14)8-13(10)18(12,16)17/h4-5,7-8,15H,2-3,6,9H2,1H3 |
| InChIKey | HESTUSOWISNDBM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|