C25H32N2O6 — CID 11712217
N-[(4aR,6S,7S,8R,8aS)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-4-aminobutanamide (PubChem CID 11712217) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is N-[(4aR,6S,7S,8R,8aS)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-4-aminobutanamide.
| Compound Name | N-[(4aR,6S,7S,8R,8aS)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-4-aminobutanamide |
|---|---|
| PubChem CID | 11712217 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | N-[(4aR,6S,7S,8R,8aS)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]-4-aminobutanamide |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@@H]1NC(=O)CCCN |
| InChI | InChI=1S/C25H32N2O6/c1-29-25-21(27-20(28)13-8-14-26)23(30-15-17-9-4-2-5-10-17)22-19(32-25)16-31-24(33-22)18-11-6-3-7-12-18/h2-7,9-12,19,21-25H,8,13-16,26H2,1H3,(H,27,28)/t19-,21+,22-,23-,24?,25+/m1/s1 |
| InChIKey | YUWWXTXSCCSEJN-BZDZWNBHSA-N |
| XLogP | 2.28 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |