C11H11Br2N — CID 117127877
2,7-dibromo-1-ethyl-3-methylindole (PubChem CID 117127877) has the molecular formula C11H11Br2N and a molecular weight of 317.02 g/mol. Its IUPAC name is 2,7-dibromo-1-ethyl-3-methylindole.
| Compound Name | 2,7-dibromo-1-ethyl-3-methylindole |
|---|---|
| PubChem CID | 117127877 |
| Molecular Formula | C11H11Br2N |
| Molecular Weight | 317.02 g/mol |
| Exact Mass | 314.93 |
| IUPAC Name | 2,7-dibromo-1-ethyl-3-methylindole |
| SMILES | CCn1c(Br)c(C)c2cccc(Br)c21 |
| InChI | InChI=1S/C11H11Br2N/c1-3-14-10-8(7(2)11(14)13)5-4-6-9(10)12/h4-6H,3H2,1-2H3 |
| InChIKey | WWJPUBMXNWRNLH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.02 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |