C13H11N3O — CID 117128159
2-(3-aminophenyl)-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 117128159) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-(3-aminophenyl)-1H-imidazo[1,2-a]pyridin-5-one.
| Compound Name | 2-(3-aminophenyl)-1H-imidazo[1,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 117128159 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-(3-aminophenyl)-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | Nc1cccc(-c2cn3c(=O)cccc3[nH]2)c1 |
| InChI | InChI=1S/C13H11N3O/c14-10-4-1-3-9(7-10)11-8-16-12(15-11)5-2-6-13(16)17/h1-8,15H,14H2 |
| InChIKey | OPUTWGGZZFCYMY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|