C13H16N4 — CID 117128402
2-(2-aminophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine (PubChem CID 117128402) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-(2-aminophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine.
| Compound Name | 2-(2-aminophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 117128402 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-(2-aminophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-amine |
| SMILES | Nc1ccccc1-c1cn2c(n1)CCC(N)C2 |
| InChI | InChI=1S/C13H16N4/c14-9-5-6-13-16-12(8-17(13)7-9)10-3-1-2-4-11(10)15/h1-4,8-9H,5-7,14-15H2 |
| InChIKey | QWXMFCRKFBQIFN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|