C12H12FN3O — CID 117128553
2-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-ol (PubChem CID 117128553) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-ol.
| Compound Name | 2-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-ol |
|---|---|
| PubChem CID | 117128553 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-(2-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-ol |
| SMILES | OC1CCCc2nc(-c3ccccc3F)nn21 |
| InChI | InChI=1S/C12H12FN3O/c13-9-5-2-1-4-8(9)12-14-10-6-3-7-11(17)16(10)15-12/h1-2,4-5,11,17H,3,6-7H2 |
| InChIKey | MWDGEWQGLZWXCS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |