C12H12ClN3O — CID 117128680
2-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-ol (PubChem CID 117128680) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-ol.
| Compound Name | 2-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-ol |
|---|---|
| PubChem CID | 117128680 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-ol |
| SMILES | OC1CCCc2nc(-c3ccc(Cl)cc3)nn21 |
| InChI | InChI=1S/C12H12ClN3O/c13-9-6-4-8(5-7-9)12-14-10-2-1-3-11(17)16(10)15-12/h4-7,11,17H,1-3H2 |
| InChIKey | HHVHFHGBQFADGS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |