C14H10ClN3O — CID 117130450
2-[(2-chlorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde (PubChem CID 117130450) has the molecular formula C14H10ClN3O and a molecular weight of 271.71 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde.
| Compound Name | 2-[(2-chlorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 117130450 |
| Molecular Formula | C14H10ClN3O |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde |
| SMILES | O=Cc1ccc2nc(Cc3ccccc3Cl)nn2c1 |
| InChI | InChI=1S/C14H10ClN3O/c15-12-4-2-1-3-11(12)7-13-16-14-6-5-10(9-19)8-18(14)17-13/h1-6,8-9H,7H2 |
| InChIKey | DUUOZOHXPOXGLD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|