C12H13N3O3S — CID 117129768
2-[(1,1-dioxothiolan-2-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde (PubChem CID 117129768) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-2-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde.
| Compound Name | 2-[(1,1-dioxothiolan-2-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 117129768 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[(1,1-dioxothiolan-2-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde |
| SMILES | O=Cc1ccc2nc(CC3CCCS3(=O)=O)nn2c1 |
| InChI | InChI=1S/C12H13N3O3S/c16-8-9-3-4-12-13-11(14-15(12)7-9)6-10-2-1-5-19(10,17)18/h3-4,7-8,10H,1-2,5-6H2 |
| InChIKey | JXFTUWVVQXAUSG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 81.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|