C13H15N3O3S — CID 117133878
2-[(1,1-dioxothian-4-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-7-carbaldehyde (PubChem CID 117133878) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-7-carbaldehyde.
| Compound Name | 2-[(1,1-dioxothian-4-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-7-carbaldehyde |
|---|---|
| PubChem CID | 117133878 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridine-7-carbaldehyde |
| SMILES | O=Cc1ccn2nc(CC3CCS(=O)(=O)CC3)nc2c1 |
| InChI | InChI=1S/C13H15N3O3S/c17-9-11-1-4-16-13(8-11)14-12(15-16)7-10-2-5-20(18,19)6-3-10/h1,4,8-10H,2-3,5-7H2 |
| InChIKey | UOPMXPBPBPOKGO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|