C13H17N3 — CID 102337829
2-(cyclohexylmethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 102337829) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(cyclohexylmethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 102337829 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-(cyclohexylmethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1ccn2nc(CC3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H17N3/c1-2-6-11(7-3-1)10-12-14-13-8-4-5-9-16(13)15-12/h4-5,8-9,11H,1-3,6-7,10H2 |
| InChIKey | QHTJVGJPBYXWPQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |