C12H16N4S — CID 117136208
2-(thian-4-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 117136208) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-(thian-4-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | 2-(thian-4-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 117136208 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-(thian-4-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | Nc1cccn2nc(CC3CCSCC3)nc12 |
| InChI | InChI=1S/C12H16N4S/c13-10-2-1-5-16-12(10)14-11(15-16)8-9-3-6-17-7-4-9/h1-2,5,9H,3-4,6-8,13H2 |
| InChIKey | WLTJEPLJQZOUCS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |