C12H13N3OS — CID 117131369
2-(thiolan-3-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde (PubChem CID 117131369) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-(thiolan-3-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde.
| Compound Name | 2-(thiolan-3-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 117131369 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-(thiolan-3-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde |
| SMILES | O=Cc1cccc2nc(CC3CCSC3)nn12 |
| InChI | InChI=1S/C12H13N3OS/c16-7-10-2-1-3-12-13-11(14-15(10)12)6-9-4-5-17-8-9/h1-3,7,9H,4-6,8H2 |
| InChIKey | STCSQECFVIFSID-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|