C15H13ClN2 — CID 117132832
2-[(4-chlorophenyl)methyl]-5-methylimidazo[1,2-a]pyridine (PubChem CID 117132832) has the molecular formula C15H13ClN2 and a molecular weight of 256.74 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-5-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-5-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117132832 |
| Molecular Formula | C15H13ClN2 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-5-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1cccc2nc(Cc3ccc(Cl)cc3)cn12 |
| InChI | InChI=1S/C15H13ClN2/c1-11-3-2-4-15-17-14(10-18(11)15)9-12-5-7-13(16)8-6-12/h2-8,10H,9H2,1H3 |
| InChIKey | OTAWYNYUDPOKFA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |